4-Methoxy-2,6-dimethylbenzenesulfonyl Chloride, 95%
cas: 55661-08-0 — see every product listed under this CAS number, including other names
4-Methoxy-2,6-dimethylbenzenesulfonyl Chloride, 95% (CAS 55661-08-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A133898-250mg |
| cas | 55661-08-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 370.38 Pln | |
| Ambeed | 1g | 915.50 Pln | |
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 328.40 Pln | |
| Chemat | 1g | 813.20 Pln | |
| Chemat | 5g | 2450.00 Pln | |
| Chemat | 10g | 4470.80 Pln | |
| BLDpharm | 5g | 2980.09 Pln | |
| BLDpharm | 100mg | 275.48 Pln | |
| BLDpharm | 250mg | 397.66 Pln | |
| BLDpharm | 1g | 980.79 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-methoxy-2,6-dimethylbenzenesulfonyl chloride (CAS 55661-08-0) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 4-methoxy-2,6-dimethylbenzenesulfonyl chloride. InChIKey: FARJAHHRGCAAOY-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 4-methoxy-2,6-dimethylbenzenesulfonyl chloride |
| InChIKey | FARJAHHRGCAAOY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1S(=O)(=O)Cl)C)OC |
Computed by PubChem (NCBI)
Synonyms:
4-methoxy-2,6-dimethylbenzene-1-sulfonyl chloride, 4-methoxy-2,6-dimethylbenzenesulfonyl chloride, 4-methoxy-2,6-dimethyl-benzenesulfonyl chloride, 2,6-Dimethyl-4-methoxybenzenesulphonyl chloride, 2,6-dimethyl-4-methoxyphenylsulfonyl chloride, 2,6-Dimethyl-4-methoxybenzenesulfonyl chloride, 4-methoxy-2,6-dimethyl-benzensulfonyl, Benzenesulfonyl chloride, 4-methoxy-2,6-dimethyl-, 4-Methoxy-2,6-dimethylbenzenesulfonylchloride, FARJAHHRGCAAOY-UHFFFAOYSA-N
