Products 90416-52-7
CAS 90416-52-7 appears in our catalog under these names: 2-Methoxy-4,5-dimethyl-benzenesulfonyl chloride, 96%, 2–Methoxy–4，5–Dimethylbenzenesulfonyl Chloride, 2-Methoxy-4,5-dimethyl-benzenesulfonyl chloride, 2-Methoxy-4,5-dimethylbenzene-1-sulfonyl chloride 98+%, 2-Methoxy-4,5-dimethyl-benzenesulfonyl chloride, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 250mg, 100mg, 10g.
2-methoxy-4,5-dimethylbenzenesulfonyl chloride (CAS 90416-52-7) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 2-methoxy-4,5-dimethylbenzenesulfonyl chloride. InChIKey: FQEJULWDCYVGCA-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 2-methoxy-4,5-dimethylbenzenesulfonyl chloride |
| InChIKey | FQEJULWDCYVGCA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1C)S(=O)(=O)Cl)OC |
Computed by PubChem (NCBI)