CAS 98995-40-5 appears in our catalog under these names: 4-Isopropoxybenzenesulfonyl chloride, 98%, 4-Isopropoxybenzene-1-sulfonyl chloride, 98%, 4-Isopropoxybenzenesulfonyl chloride, 96% , 4-Isopropoxybenzenesulfonyl Chloride, >98.0%(GC), 4-Isopropoxybenzene-1-sulfonyl chloride 95%. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), TCI, Chemat. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 250mg.
4-propan-2-yloxybenzenesulfonyl chloride (CAS 98995-40-5) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 4-propan-2-yloxybenzenesulfonyl chloride. InChIKey: IJWCRHKAQNFJLT-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 4-propan-2-yloxybenzenesulfonyl chloride |
| InChIKey | IJWCRHKAQNFJLT-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)