Products 55661-08-0

CAS 55661-08-0 appears in our catalog under these names: 4-Methoxy-2,6-dimethylbenzenesulfonyl chloride, 97%, 4–Methoxy–2,6–dimethylbenzenesulfonyl Chloride, 4-Methoxy-2,6-dimethylbenzenesulfonyl Chloride 95%, 4-Methoxy-2,6-dimethylbenzenesulfonyl Chloride, 95%, 95%, 4-Methoxy-2,6-dimethylbenzene-1-sulfonyl chloride. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 250mg, 1g, 25g, 100mg.

Structural formula: {0} (CAS {1})

4-methoxy-2,6-dimethylbenzenesulfonyl chloride (CAS 55661-08-0) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 4-methoxy-2,6-dimethylbenzenesulfonyl chloride. InChIKey: FARJAHHRGCAAOY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11ClO3S
Molecular weight234.70 g/mol
IUPAC name4-methoxy-2,6-dimethylbenzenesulfonyl chloride
InChIKeyFARJAHHRGCAAOY-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1S(=O)(=O)Cl)C)OC

Computed by PubChem (NCBI)