CAS 91179-11-2 is the registry number for 5-Methoxy-2,4-dimethylbenzenesulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
5-methoxy-2,4-dimethylbenzenesulfonyl chloride (CAS 91179-11-2) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 5-methoxy-2,4-dimethylbenzenesulfonyl chloride. InChIKey: AMZJHRQSVQIDBS-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 5-methoxy-2,4-dimethylbenzenesulfonyl chloride |
| InChIKey | AMZJHRQSVQIDBS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1OC)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)