CAS 91179-12-3 appears in our catalog under these names: 4-Methoxy-2,5-dimethylbenzene-1-sulfonyl chloride, 95%, 4-Methoxy-2,5-dimethylbenzene-1-sulfonyl chloride 97%, 4-methoxy-2,5-dimethylbenzene-1-sulfonyl chloride, 97%, 97%, 2,5-Dimethyl-4-methoxybenzenesulfonylchloride, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
4-methoxy-2,5-dimethylbenzenesulfonyl chloride (CAS 91179-12-3) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 4-methoxy-2,5-dimethylbenzenesulfonyl chloride. InChIKey: RGOCLWBHRMQADB-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 4-methoxy-2,5-dimethylbenzenesulfonyl chloride |
| InChIKey | RGOCLWBHRMQADB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1S(=O)(=O)Cl)C)OC |
Computed by PubChem (NCBI)