CAS 58076-32-7 appears in our catalog under these names: 4-Propoxybenzenesulfonyl chloride, 95%, 4-Propoxybenzene-1-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-propoxybenzenesulfonyl chloride (CAS 58076-32-7) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 4-propoxybenzenesulfonyl chloride. InChIKey: LHYZGURMLPSRFU-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 4-propoxybenzenesulfonyl chloride |
| InChIKey | LHYZGURMLPSRFU-UHFFFAOYSA-N |
| SMILES | CCCOC1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)