cas: 20440-94-2 — see every product listed under this CAS number, including other names
4-Methoxy-N-(4-methoxyphenyl)-N-phenylaniline 95% (CAS 20440-94-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A148466-250mg |
| cas | 20440-94-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 275.81 Pln | |
| Ambeed | 25g | 409.31 Pln | |
| Ambeed | 100g | 1288.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A148466 |
4-methoxy-N-(4-methoxyphenyl)-N-phenylaniline (CAS 20440-94-2) is a chemical compound with the molecular formula C20H19NO2 and a molecular weight of 305.4 g/mol. IUPAC name: 4-methoxy-N-(4-methoxyphenyl)-N-phenylaniline. InChIKey: ZJPTYHDCQPDNBH-UHFFFAOYSA-N.
| Molecular formula | C20H19NO2 |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | 4-methoxy-N-(4-methoxyphenyl)-N-phenylaniline |
| InChIKey | ZJPTYHDCQPDNBH-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=C(C=C3)OC |
Computed by PubChem (NCBI)