cas: 368-91-2 — see every product listed under this CAS number, including other names
4-Methoxybenzenesulfonyl fluoride, 99% (CAS 368-91-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F695228-1G |
| cas | 368-91-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 789.32 Pln | |
| Fluorochem | 5g | 2830.27 Pln |
| purity | 99% |
|---|---|
| delivery time | 3-4 weeks |
4-methoxybenzenesulfonyl fluoride (CAS 368-91-2) is a chemical compound with the molecular formula C7H7FO3S and a molecular weight of 190.19 g/mol. IUPAC name: 4-methoxybenzenesulfonyl fluoride. InChIKey: QHEMDSDRFAIOOU-UHFFFAOYSA-N.
| Molecular formula | C7H7FO3S |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 4-methoxybenzenesulfonyl fluoride |
| InChIKey | QHEMDSDRFAIOOU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)F |
Computed by PubChem (NCBI)