CAS 858004-78-1 is the registry number for 4-(Hydroxymethyl)benzene-1-sulfonyl fluoride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-(hydroxymethyl)benzenesulfonyl fluoride (CAS 858004-78-1) is a chemical compound with the molecular formula C7H7FO3S and a molecular weight of 190.19 g/mol. IUPAC name: 4-(hydroxymethyl)benzenesulfonyl fluoride. InChIKey: MVZMZGSMOCVHFQ-UHFFFAOYSA-N.
| Molecular formula | C7H7FO3S |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 4-(hydroxymethyl)benzenesulfonyl fluoride |
| InChIKey | MVZMZGSMOCVHFQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)S(=O)(=O)F |
Computed by PubChem (NCBI)