CAS 565-45-7 is the registry number for Methyl 4-fluorobenzene-1-sulfonate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl 4-fluorobenzenesulfonate (CAS 565-45-7) is a chemical compound with the molecular formula C7H7FO3S and a molecular weight of 190.19 g/mol. IUPAC name: methyl 4-fluorobenzenesulfonate. InChIKey: MBFSZLDWZHRFRI-UHFFFAOYSA-N.
| Molecular formula | C7H7FO3S |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | methyl 4-fluorobenzenesulfonate |
| InChIKey | MBFSZLDWZHRFRI-UHFFFAOYSA-N |
| SMILES | COS(=O)(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)