CAS 2060020-74-6 is the registry number for 4-Fluoro-3-methanesulfonylphenol, 95%. Offered by: AmBeed. Available pack sizes: 1g.
4-fluoro-3-methylsulfonylphenol (CAS 2060020-74-6) is a chemical compound with the molecular formula C7H7FO3S and a molecular weight of 190.19 g/mol. IUPAC name: 4-fluoro-3-methylsulfonylphenol. InChIKey: QJNJWVWFIZRNEJ-UHFFFAOYSA-N.
| Molecular formula | C7H7FO3S |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 4-fluoro-3-methylsulfonylphenol |
| InChIKey | QJNJWVWFIZRNEJ-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC(=C1)O)F |
Computed by PubChem (NCBI)