CAS 96892-89-6 is the registry number for 3-(Hydroxymethyl)benzene-1-sulfonyl fluoride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-(hydroxymethyl)benzenesulfonyl fluoride (CAS 96892-89-6) is a chemical compound with the molecular formula C7H7FO3S and a molecular weight of 190.19 g/mol. IUPAC name: 3-(hydroxymethyl)benzenesulfonyl fluoride. InChIKey: IFZQUNIVKIALDN-UHFFFAOYSA-N.
| Molecular formula | C7H7FO3S |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 3-(hydroxymethyl)benzenesulfonyl fluoride |
| InChIKey | IFZQUNIVKIALDN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)F)CO |
Computed by PubChem (NCBI)