4-Methoxycarbonyl-2,6-difluorophenylboronic acid, 97%
cas: 2022984-58-1 — see every product listed under this CAS number, including other names
4-Methoxycarbonyl-2,6-difluorophenylboronic acid, 97% (CAS 2022984-58-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F694687-250MG |
| cas | 2022984-58-1 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 581.06 Pln | |
| Fluorochem | 5g | 1934.75 Pln | |
| Fluorochem | 10g | 3215.55 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2,6-difluoro-4-methoxycarbonylphenyl)boronic acid (CAS 2022984-58-1) is a chemical compound with the molecular formula C8H7BF2O4 and a molecular weight of 215.95 g/mol. IUPAC name: (2,6-difluoro-4-methoxycarbonylphenyl)boronic acid. InChIKey: UAQVWIOVTATRBS-UHFFFAOYSA-N.
| Molecular formula | C8H7BF2O4 |
|---|---|
| Molecular weight | 215.95 g/mol |
| IUPAC name | (2,6-difluoro-4-methoxycarbonylphenyl)boronic acid |
| InChIKey | UAQVWIOVTATRBS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)C(=O)OC)F)(O)O |
Computed by PubChem (NCBI)