CAS 2143-88-6 appears in our catalog under these names: 1-(4-Methylphenyl)-4-nitrobenzene, 95%, 4-Methyl-4'-nitro-1,1'-biphenyl, 95%, 4-Methyl-4'-nitro-1,1'-biphenyl, ≥99.7%, ≥99.7%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 25g.
1-methyl-4-(4-nitrophenyl)benzene (CAS 2143-88-6) is a chemical compound with the molecular formula C13H11NO2 and a molecular weight of 213.23 g/mol. IUPAC name: 1-methyl-4-(4-nitrophenyl)benzene. InChIKey: XAIDWOFGGNDTPE-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2 |
|---|---|
| Molecular weight | 213.23 g/mol |
| IUPAC name | 1-methyl-4-(4-nitrophenyl)benzene |
| InChIKey | XAIDWOFGGNDTPE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)