CAS 3274-12-2 appears in our catalog under these names: 4–Methyl–4–(trichloromethyl)cyclohexa–2,5–dienone, 4-Methyl-4-(trichloromethyl)cyclohexa-2,5-dienone, 97%, 97%. Offered by: GLPBio, Chemat. Available pack sizes: 100g, 25g, 500g.
4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-one (CAS 3274-12-2) is a chemical compound with the molecular formula C8H7Cl3O and a molecular weight of 225.5 g/mol. IUPAC name: 4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-one. InChIKey: RCHALGLCCGJUAE-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3O |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | 4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-one |
| InChIKey | RCHALGLCCGJUAE-UHFFFAOYSA-N |
| SMILES | CC1(C=CC(=O)C=C1)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)