4-Methyl-4-(trichloromethyl)cyclohexa-2,5-dienone, 97%
cas: 3274-12-2 — see every product listed under this CAS number, including other names
4-Methyl-4-(trichloromethyl)cyclohexa-2,5-dienone, 97% (CAS 3274-12-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A101565-10g |
| cas | 3274-12-2 |
| size | 10g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 175.69 Pln | |
| Ambeed | 25g | 197.94 Pln | |
| Ambeed | 100g | 342.56 Pln | |
| Ambeed | 500g | 1438.38 Pln | |
| BLDpharm | 10g | 186.63 Pln | |
| BLDpharm | 25g | 208.84 Pln | |
| BLDpharm | 100g | 364.34 Pln | |
| BLDpharm | 500g | 1547.26 Pln | |
| Chemat | 25g | 189.20 Pln | |
| Fluorochem | 100g | 1023.62 Pln | |
| Fluorochem | 25g | 325.94 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-one (CAS 3274-12-2) is a chemical compound with the molecular formula C8H7Cl3O and a molecular weight of 225.5 g/mol. IUPAC name: 4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-one. InChIKey: RCHALGLCCGJUAE-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3O |
|---|---|
| Molecular weight | 225.5 g/mol |
| IUPAC name | 4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-one |
| InChIKey | RCHALGLCCGJUAE-UHFFFAOYSA-N |
| SMILES | CC1(C=CC(=O)C=C1)C(Cl)(Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Methyl-4-(trichloromethyl)cyclohexa-2,5-dienone, 4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-one, 4-Methyl-4-(trichloromethyl)-2,5-cyclohexadien-1-one, 4-Trichloromethyl-4-methyl-2,5-cyclohexadienone, 4-Trichloromethyl-4-methyl-2,5-cyclohexadien-1-one, 4-methyl-4-trichloromethylcyclohexa-2,5-dienone, 2,5-Cyclohexadien-1-one, 4-methyl-4-(trichloromethyl)-, 4-Methyl-4-(trichloromethyl)-2,5-cyclohexadien-1-one #