cas: 87700-67-2 — see every product listed under this CAS number, including other names
4-Methylnaphthalene-1-carbonyl chloride (CAS 87700-67-2) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115NCL-200mg |
| cas | 87700-67-2 |
| size | 200mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 200mg | 126.80 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 774.80 Pln |
| delivery time | 3 weeks |
|---|
4-methylnaphthalene-1-carbonyl chloride (CAS 87700-67-2) is a chemical compound with the molecular formula C12H9ClO and a molecular weight of 204.65 g/mol. IUPAC name: 4-methylnaphthalene-1-carbonyl chloride. InChIKey: IXGMHYHWSPDNNS-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 4-methylnaphthalene-1-carbonyl chloride |
| InChIKey | IXGMHYHWSPDNNS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C2=CC=CC=C12)C(=O)Cl |
Computed by PubChem (NCBI)