cas: 252720-32-4 — see every product listed under this CAS number, including other names
4-N-Boc-Amino-1-Cbz-piperidine-4-carboxylic acid, 98% (CAS 252720-32-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F041358-250MG |
| cas | 252720-32-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 393.63 Pln | |
| Fluorochem | 1g | 1216.26 Pln | |
| Fluorochem | 5g | 3158.28 Pln | |
| Fluorochem | 25g | 10353.66 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phenylmethoxycarbonylpiperidine-4-carboxylic acid (CAS 252720-32-4) is a chemical compound with the molecular formula C19H26N2O6 and a molecular weight of 378.4 g/mol. IUPAC name: 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phenylmethoxycarbonylpiperidine-4-carboxylic acid. InChIKey: BGRHKAAVXJAPGP-UHFFFAOYSA-N.
| Molecular formula | C19H26N2O6 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]-1-phenylmethoxycarbonylpiperidine-4-carboxylic acid |
| InChIKey | BGRHKAAVXJAPGP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCN(CC1)C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)