cas: 122-04-3 — see every product listed under this CAS number, including other names
4-Nitrobenzoyl Chloride, >98.0%(GC)(T) (CAS 122-04-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0176-25G |
| cas | 122-04-3 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 208.35 Pln | |
| TCI | 500g | 582.06 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
4-nitrobenzoyl chloride (CAS 122-04-3) is a chemical compound with the molecular formula C7H4ClNO3 and a molecular weight of 185.56 g/mol. IUPAC name: 4-nitrobenzoyl chloride. InChIKey: SKDHHIUENRGTHK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3 |
|---|---|
| Molecular weight | 185.56 g/mol |
| IUPAC name | 4-nitrobenzoyl chloride |
| InChIKey | SKDHHIUENRGTHK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)