cas: 122-04-3 — see every product listed under this CAS number, including other names
4-Nitrobenzoyl chloride, 98% (CAS 122-04-3) is a chemical reagent available from Chemat. Available pack sizes: 500g, 25g, 100g, 5g, 250g, 50G. Offered by: Combi-blocks, Thermo Scientific (Acros), Sigma-Aldrich.
| brand | Combi-blocks |
|---|---|
| catalog number | QE-7199-500g |
| cas | 122-04-3 |
| size | 500g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 500g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 100g | price on request | |
| Thermo Scientific (Acros) | 5g | 114.48 Pln | |
| Thermo Scientific (Acros) | 100g | 153.23 Pln | |
| Thermo Scientific (Acros) | 250g | 298.45 Pln | |
| Thermo Scientific (Acros) | 500g | 547.90 Pln | |
| Sigma-Aldrich | 250G | 559.00 Pln | |
| Sigma-Aldrich | 500G | 891.00 Pln | |
| Sigma-Aldrich | 50G | 180.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
4-nitrobenzoyl chloride (CAS 122-04-3) is a chemical compound with the molecular formula C7H4ClNO3 and a molecular weight of 185.56 g/mol. IUPAC name: 4-nitrobenzoyl chloride. InChIKey: SKDHHIUENRGTHK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO3 |
|---|---|
| Molecular weight | 185.56 g/mol |
| IUPAC name | 4-nitrobenzoyl chloride |
| InChIKey | SKDHHIUENRGTHK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)