CAS 5332-96-7 appears in our catalog under these names: 4-Nitrophenylacetone, 98% , (4-Nitrophenyl)acetone, 4-Nitrophenylacetone 97%, 4-NITROPHENYLACETONE, 95%. Offered by: Thermo Scientific (Alfa Aesar), Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 25g, 50g, 100g, 250g, 500g, 1000g.
1-(4-nitrophenyl)propan-2-one (CAS 5332-96-7) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 1-(4-nitrophenyl)propan-2-one. InChIKey: GEWWCWZGHNIUBW-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 1-(4-nitrophenyl)propan-2-one |
| InChIKey | GEWWCWZGHNIUBW-UHFFFAOYSA-N |
| SMILES | CC(=O)CC1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)