cas: 29968-78-3 — see every product listed under this CAS number, including other names
4-Nitrophenylethylamine hydrochloride, 98%, 98% (CAS 29968-78-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I6KQ-5g |
| cas | 29968-78-3 |
| size | 5g |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 50g | 122.00 Pln | |
| Chemat | 100g | 179.60 Pln | |
| Chemat | 250g | 333.20 Pln | |
| Chemat | 500g | 614.40 Pln | |
| Chemat | 1kg | 1149.20 Pln | |
| Chemat | 5kg | 5692.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(4-nitrophenyl)ethanamine;hydrochloride (CAS 29968-78-3) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: 2-(4-nitrophenyl)ethanamine;hydrochloride. InChIKey: JVMHULJEYUQYSH-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 2-(4-nitrophenyl)ethanamine;hydrochloride |
| InChIKey | JVMHULJEYUQYSH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCN)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)