CAS 132873-57-5 appears in our catalog under these names: (S)-Alpha-methyl-4-nitrobenzylamine hydrochloride, 98%, (S)-1-(4-Nitrophenyl)ethanamine Hydrochloride, (S)–α–Methyl–4–nitrobenzylamine Hydrochloride, (S)-alpha-Methyl-4-nitrobenzylamine Hydrochloride, >99.0%(T), (S)-1-(4-Nitrophenyl)ethanamine hydrochloride 98%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 25g, 5g, 100g, 1g, 2,5g, 250mg, 10g, 500g.
(1S)-1-(4-nitrophenyl)ethanamine;hydrochloride (CAS 132873-57-5) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: (1S)-1-(4-nitrophenyl)ethanamine;hydrochloride. InChIKey: CZQQGVFHLSBEDV-RGMNGODLSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | (1S)-1-(4-nitrophenyl)ethanamine;hydrochloride |
| InChIKey | CZQQGVFHLSBEDV-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)