cas: 1131-61-9 — see every product listed under this CAS number, including other names
4-PHENYLPYRIDINE N-OXIDE, 98% (CAS 1131-61-9) is a chemical reagent available from Chemat. Available pack sizes: 25G, 5G, 250mg, 1g. Offered by: Sigma-Aldrich, Fluorochem.
| brand | Sigma-Aldrich |
|---|---|
| catalog number | 183490-25G |
| cas | 1131-61-9 |
| size | 25G |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Sigma-Aldrich | 25G | 1290.00 Pln | |
| Sigma-Aldrich | 5G | 528.00 Pln | |
| Fluorochem | 5g | 539.42 Pln | |
| Fluorochem | 250mg | 138.51 Pln | |
| Fluorochem | 1g | 247.85 Pln | |
| Fluorochem | 25g | 2080.54 Pln |
| purity | No data |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1-oxido-4-phenylpyridin-1-ium (CAS 1131-61-9) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 1-oxido-4-phenylpyridin-1-ium. InChIKey: VZOPVKZLLGMDDG-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 1-oxido-4-phenylpyridin-1-ium |
| InChIKey | VZOPVKZLLGMDDG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=[N+](C=C2)[O-] |
Computed by PubChem (NCBI)