cas: 1131-61-9 — see every product listed under this CAS number, including other names
4-Phenylpyridine N-Oxide, >98.0%(HPLC)(T) (CAS 1131-61-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P1406-5G |
| cas | 1131-61-9 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 855.93 Pln | |
| TCI | 25g | 3280.14 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
1-oxido-4-phenylpyridin-1-ium (CAS 1131-61-9) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 1-oxido-4-phenylpyridin-1-ium. InChIKey: VZOPVKZLLGMDDG-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 1-oxido-4-phenylpyridin-1-ium |
| InChIKey | VZOPVKZLLGMDDG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=[N+](C=C2)[O-] |
Computed by PubChem (NCBI)