4-Phenylcinnamic acid, 95% (E)
cas: 13026-23-8 — see every product listed under this CAS number, including other names
4-Phenylcinnamic acid, 95% (E) (CAS 13026-23-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A586234-1g |
| cas | 13026-23-8 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 259.12 Pln | |
| Ambeed | 10g | 426.00 Pln | |
| Ambeed | 25g | 915.50 Pln | |
| Ambeed | 100g | 3385.25 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 275.48 Pln | |
| BLDpharm | 10g | 453.20 Pln | |
| BLDpharm | 25g | 980.79 Pln | |
| BLDpharm | 100g | 3640.96 Pln |
properties
| purity | 95% (E) |
|---|---|
| delivery time | 1-2 weeks |
(E)-3-(4-phenylphenyl)prop-2-enoic acid (CAS 13026-23-8) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: (E)-3-(4-phenylphenyl)prop-2-enoic acid. InChIKey: DMJDEZUEYXVYNO-DHZHZOJOSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | (E)-3-(4-phenylphenyl)prop-2-enoic acid |
| InChIKey | DMJDEZUEYXVYNO-DHZHZOJOSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Phenylcinnamic acid, (E)-3-([1,1'-biphenyl]-4-yl)acrylic acid, 3-([1,1'-Biphenyl]-4-yl)acrylic acid, (2E)-3-(4-phenylphenyl)prop-2-enoic acid, (E)-3-(4-phenylphenyl)prop-2-enoic acid, 3-(4-phenylphenyl)prop-2-enoic acid, 3-[1,1'-biphenyl]-4-ylacrylic acid, 2-propenoic acid, 3-[1,1'-biphenyl]-4-yl-, (2E)-, 3-[1,1'-Biphenyl]-4-yl-2-propenoic acid, AldrichCPR, (2E)-3-biphenyl-4-ylacrylic acid
![3-([1,1'-Biphenyl]-4-yl)acrylic acid, 97%](https://cdn.chemat.com.pl/products/images/ec1aacc2c2beb4f164caa0e3dc424119ff3744317d7f7fba897d13db2602b7b3.svg)