Products 99822-84-1
CAS 99822-84-1 appears in our catalog under these names: 4-Phenylthiazole-5-carboxylic acid, 95%, 95%, 5-Thiazolecarboxylic acid, 4-phenyl-, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
4-phenyl-1,3-thiazole-5-carboxylic acid (CAS 99822-84-1) is a chemical compound with the molecular formula C10H7NO2S and a molecular weight of 205.23 g/mol. IUPAC name: 4-phenyl-1,3-thiazole-5-carboxylic acid. InChIKey: NGTZFWMOTDGMKO-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 4-phenyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | NGTZFWMOTDGMKO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(SC=N2)C(=O)O |
Computed by PubChem (NCBI)