Products 937369-77-2
CAS 937369-77-2 appears in our catalog under these names: 5-Phenylthiazole-2-carboxylic acid, 95%, 5-Phenylthiazole-2-carboxylic acid, 97%, 5-Phenylthiazole-2-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
5-phenyl-1,3-thiazole-2-carboxylic acid (CAS 937369-77-2) is a chemical compound with the molecular formula C10H7NO2S and a molecular weight of 205.23 g/mol. IUPAC name: 5-phenyl-1,3-thiazole-2-carboxylic acid. InChIKey: TZRNZBGFPPOHOB-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 5-phenyl-1,3-thiazole-2-carboxylic acid |
| InChIKey | TZRNZBGFPPOHOB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(S2)C(=O)O |
Computed by PubChem (NCBI)