CAS 59020-44-9 appears in our catalog under these names: 4-Phenyl-1,3-thiazole-2-carboxylic acid, 95%, 4-Phenylthiazole-2-carboxylic acid 98%, 4-Phenylthiazole-2-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 25g, 100mg, 250mg.
4-phenyl-1,3-thiazole-2-carboxylic acid (CAS 59020-44-9) is a chemical compound with the molecular formula C10H7NO2S and a molecular weight of 205.23 g/mol. IUPAC name: 4-phenyl-1,3-thiazole-2-carboxylic acid. InChIKey: ORSGNNVYFOPYKB-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 4-phenyl-1,3-thiazole-2-carboxylic acid |
| InChIKey | ORSGNNVYFOPYKB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=N2)C(=O)O |
Computed by PubChem (NCBI)