Products 123530-67-6
CAS 123530-67-6 appears in our catalog under these names: 3-Benzothiazol-2-yl-acrylic acid, 95%, 3-Benzothiazol-2-yl-acrylic acid, (2E)-3-(1,3-benzothiazol-2-yl)prop-2-enoic acid, >=95%. Offered by: Combi-blocks, Biosynth, Enamine. Available pack sizes: 10g, 25g, 1g, 5g, 50g, 50mg, 0,5g.
(E)-3-(1,3-benzothiazol-2-yl)prop-2-enoic acid (CAS 123530-67-6) is a chemical compound with the molecular formula C10H7NO2S and a molecular weight of 205.23 g/mol. IUPAC name: (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoic acid. InChIKey: LLWKVCNWFMPGGM-AATRIKPKSA-N.
| Molecular formula | C10H7NO2S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoic acid |
| InChIKey | LLWKVCNWFMPGGM-AATRIKPKSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-Benzothiazol-2-yl-acrylic acid, (E)-3-(benzo[d]thiazol-2-yl)acrylic acid, (E)-3-(1,3-benzothiazol-2-yl)prop-2-enoic acid, 2-Propenoic acid, 3-(2-benzothiazolyl)-, (2E)-, 3-(benzo[d]thiazol-2-yl)acrylic acid, (2E)-3-benzothiazol-2-ylprop-2-enoic acid, 3-(1,3-benzothiazol-2-yl)prop-2-enoic acid, 2-Propenoicacid,3-(2-benzothiazolyl)-,(E)-(9CI), orb3170349, 3-(1,3-benzothiazol-2-yl)acrylic acid