Products 7113-10-2
CAS 7113-10-2 appears in our catalog under these names: 2–phenylthiazole–4–carboxylic acid, 2-Phenylthiazole-4-carboxylic acid, 97% , 2-Phenylthiazole-4-carboxylic acid 95%, 2-Phenylthiazole-4-carboxylic acid, 95%, 2-Phenylthiazole-4-carboxylic acid, 95%, 95%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 2.5g.
2-phenyl-1,3-thiazole-4-carboxylic acid (CAS 7113-10-2) is a chemical compound with the molecular formula C10H7NO2S and a molecular weight of 205.23 g/mol. IUPAC name: 2-phenyl-1,3-thiazole-4-carboxylic acid. InChIKey: IBUSLNJQKLZPNR-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 2-phenyl-1,3-thiazole-4-carboxylic acid |
| InChIKey | IBUSLNJQKLZPNR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)