4-Phenylthiophen-2-amine, 95%
cas: 67637-83-6 — see every product listed under this CAS number, including other names
4-Phenylthiophen-2-amine, 95% (CAS 67637-83-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A158605-250mg |
| cas | 67637-83-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 865.44 Pln | |
| Ambeed | 1g | 2345.06 Pln | |
| BLDpharm | 100mg | 553.16 Pln | |
| BLDpharm | 250mg | 925.25 Pln | |
| BLDpharm | 1g | 2524.69 Pln | |
| Chemat | 100mg | 563.60 Pln | |
| Chemat | 250mg | 1053.20 Pln | |
| Chemat | 1g | 2541.20 Pln | |
| Chemat | 5g | 9981.20 Pln | |
| Fluorochem | 100mg | 1039.24 Pln | |
| Fluorochem | 250mg | 1945.17 Pln | |
| Fluorochem | 1g | 4704.61 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
4-phenylthiophen-2-amine (CAS 67637-83-6) is a chemical compound with the molecular formula C10H9NS and a molecular weight of 175.25 g/mol. IUPAC name: 4-phenylthiophen-2-amine. InChIKey: ZIDLLXZOOHLVHZ-UHFFFAOYSA-N.
| Molecular formula | C10H9NS |
|---|---|
| Molecular weight | 175.25 g/mol |
| IUPAC name | 4-phenylthiophen-2-amine |
| InChIKey | ZIDLLXZOOHLVHZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CSC(=C2)N |
Computed by PubChem (NCBI)