cas: 912280-35-4 — see every product listed under this CAS number, including other names
4-hydroxynaphthalen-1-yl methacrylate, 95%, 95% (CAS 912280-35-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FVJF-100mg |
| cas | 912280-35-4 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 890.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(4-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate (CAS 912280-35-4) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: (4-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate. InChIKey: WZAHBKNHKAFCNM-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | (4-hydroxynaphthalen-1-yl) 2-methylprop-2-enoate |
| InChIKey | WZAHBKNHKAFCNM-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OC1=CC=C(C2=CC=CC=C21)O |
Computed by PubChem (NCBI)