Products 5519-23-3
CAS 5519-23-3 appears in our catalog under these names: 4-N-Decyloxybenzoic acid, 95%, 4–(Decyloxy)benzoic Acid, 4-n-Decyloxybenzoic acid, 96% , 4-(Decyloxy)benzoic Acid, >98.0%(GC)(T), 4-(Decyloxy)benzoic acid 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 25g, 5g, 1g, 100g, 250mg.
4-decoxybenzoic acid (CAS 5519-23-3) is a chemical compound with the molecular formula C17H26O3 and a molecular weight of 278.4 g/mol. IUPAC name: 4-decoxybenzoic acid. InChIKey: NZNICZRIRMGOFG-UHFFFAOYSA-N.
| Molecular formula | C17H26O3 |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | 4-decoxybenzoic acid |
| InChIKey | NZNICZRIRMGOFG-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCOC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)