CAS 49763-65-7 appears in our catalog under these names: 4-Pentylbenzoyl chloride, 95%, 4-n-Pentylbenzoyl chloride, 98% , 4-Pentylbenzoyl Chloride, >98.0%(GC)(T), 4-PENTYLBENZOYL CHLORIDE, 96%, 4-pentylbenzoyl chloride, 98%(GC-MS),RG. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), TCI, Sigma-Aldrich, Fluorochem. Available pack sizes: 1g, 25g, 100g, 5g, 250mg.
4-pentylbenzoyl chloride (CAS 49763-65-7) is a chemical compound with the molecular formula C12H15ClO and a molecular weight of 210.70 g/mol. IUPAC name: 4-pentylbenzoyl chloride. InChIKey: FBBRKYLXMNQFQU-UHFFFAOYSA-N.
| Molecular formula | C12H15ClO |
|---|---|
| Molecular weight | 210.70 g/mol |
| IUPAC name | 4-pentylbenzoyl chloride |
| InChIKey | FBBRKYLXMNQFQU-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC=C(C=C1)C(=O)Cl |
Computed by PubChem (NCBI)