cas: 147750-20-7 — see every product listed under this CAS number, including other names
5,6,7,8-Tetrahydro-2-(trifluoromethyl)-4(3H)-quinazolinone, 97%, 97% (CAS 147750-20-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112F65-100mg |
| cas | 147750-20-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1096.40 Pln | |
| Chemat | 250mg | 1782.80 Pln | |
| Chemat | 1g | 3506.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(trifluoromethyl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one (CAS 147750-20-7) is a chemical compound with the molecular formula C9H9F3N2O and a molecular weight of 218.18 g/mol. IUPAC name: 2-(trifluoromethyl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one. InChIKey: BCJOPFSBBJDRPE-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O |
|---|---|
| Molecular weight | 218.18 g/mol |
| IUPAC name | 2-(trifluoromethyl)-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
| InChIKey | BCJOPFSBBJDRPE-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=O)NC(=N2)C(F)(F)F |
Computed by PubChem (NCBI)