Products 954417-62-0
CAS 954417-62-0 is the registry number for 4-Amino-n-methyl-3-(trifluoromethyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-amino-N-methyl-3-(trifluoromethyl)benzamide (CAS 954417-62-0) is a chemical compound with the molecular formula C9H9F3N2O and a molecular weight of 218.18 g/mol. IUPAC name: 4-amino-N-methyl-3-(trifluoromethyl)benzamide. InChIKey: AIDMFPRPJVPPOD-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O |
|---|---|
| Molecular weight | 218.18 g/mol |
| IUPAC name | 4-amino-N-methyl-3-(trifluoromethyl)benzamide |
| InChIKey | AIDMFPRPJVPPOD-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=C(C=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)