CAS 1022901-66-1 is the registry number for 5-(Dimethylamino)-2-(2,2,2-trifluoroacetyl)penta-2,4-dienenitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
(2E,4E)-5-(dimethylamino)-2-(2,2,2-trifluoroacetyl)penta-2,4-dienenitrile (CAS 1022901-66-1) is a chemical compound with the molecular formula C9H9F3N2O and a molecular weight of 218.18 g/mol. IUPAC name: (2E,4E)-5-(dimethylamino)-2-(2,2,2-trifluoroacetyl)penta-2,4-dienenitrile. InChIKey: QEBYTZVFLQLFRY-HJIKTHEYSA-N.
| Molecular formula | C9H9F3N2O |
|---|---|
| Molecular weight | 218.18 g/mol |
| IUPAC name | (2E,4E)-5-(dimethylamino)-2-(2,2,2-trifluoroacetyl)penta-2,4-dienenitrile |
| InChIKey | QEBYTZVFLQLFRY-HJIKTHEYSA-N |
| SMILES | CN(C)/C=C/C=C(\C#N)/C(=O)C(F)(F)F |
Computed by PubChem (NCBI)