CAS 260973-22-6 appears in our catalog under these names: 3-Amino-n-(2,2,2-trifluoroethyl)benzamide, 97%, 3-Amino-n-(2,2,2-trifluoroethyl)benzamide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 10g, 5g, 2,5g.
3-amino-N-(2,2,2-trifluoroethyl)benzamide (CAS 260973-22-6) is a chemical compound with the molecular formula C9H9F3N2O and a molecular weight of 218.18 g/mol. IUPAC name: 3-amino-N-(2,2,2-trifluoroethyl)benzamide. InChIKey: ZBBZFKFGADOTAS-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O |
|---|---|
| Molecular weight | 218.18 g/mol |
| IUPAC name | 3-amino-N-(2,2,2-trifluoroethyl)benzamide |
| InChIKey | ZBBZFKFGADOTAS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C(=O)NCC(F)(F)F |
Computed by PubChem (NCBI)