CAS 230305-72-3 is the registry number for 1-[4-(Dimethylamino)-3-pyridinyl]-2,2,2-trifluoro-ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
1-[4-(dimethylamino)-3-pyridinyl]-2,2,2-trifluoroethanone (CAS 230305-72-3) is a chemical compound with the molecular formula C9H9F3N2O and a molecular weight of 218.18 g/mol. IUPAC name: 1-[4-(dimethylamino)-3-pyridinyl]-2,2,2-trifluoroethanone. InChIKey: UKVCDCYVFCNNMP-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O |
|---|---|
| Molecular weight | 218.18 g/mol |
| IUPAC name | 1-[4-(dimethylamino)-3-pyridinyl]-2,2,2-trifluoroethanone |
| InChIKey | UKVCDCYVFCNNMP-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=NC=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)