CAS 1707983-91-2 is the registry number for N,N-Dimethyl-5-(trifluoromethyl)pyridine-2-carboxamide, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
N,N-dimethyl-5-(trifluoromethyl)pyridine-2-carboxamide (CAS 1707983-91-2) is a chemical compound with the molecular formula C9H9F3N2O and a molecular weight of 218.18 g/mol. IUPAC name: N,N-dimethyl-5-(trifluoromethyl)pyridine-2-carboxamide. InChIKey: GUNWRJIGBBJVKF-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O |
|---|---|
| Molecular weight | 218.18 g/mol |
| IUPAC name | N,N-dimethyl-5-(trifluoromethyl)pyridine-2-carboxamide |
| InChIKey | GUNWRJIGBBJVKF-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=NC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)