CAS 925393-51-7 is the registry number for 2-[3-(Trifluoromethyl)phenyl]acetamidoxime, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N'-hydroxy-2-[3-(trifluoromethyl)phenyl]ethanimidamide (CAS 925393-51-7) is a chemical compound with the molecular formula C9H9F3N2O and a molecular weight of 218.18 g/mol. IUPAC name: N'-hydroxy-2-[3-(trifluoromethyl)phenyl]ethanimidamide. InChIKey: QEYLQLHFBVNBCI-UHFFFAOYSA-N.
| Molecular formula | C9H9F3N2O |
|---|---|
| Molecular weight | 218.18 g/mol |
| IUPAC name | N'-hydroxy-2-[3-(trifluoromethyl)phenyl]ethanimidamide |
| InChIKey | QEYLQLHFBVNBCI-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C/C(=N/O)/N |
Computed by PubChem (NCBI)