5,6-Dibromo-1,2-dihydroacenaphthylene, 98%, 98%
cas: 19190-91-1 — see every product listed under this CAS number, including other names
5,6-Dibromo-1,2-dihydroacenaphthylene, 98%, 98% (CAS 19190-91-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250g, 500g, 1kg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113FJY-100mg |
| cas | 19190-91-1 |
| size | 100mg |
| availability | 1000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250g | 3227.60 Pln | |
| Chemat | 500g | 4699.20 Pln | |
| Chemat | 1kg | 8296.40 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 366.80 Pln | |
| Chemat | 10g | 616.40 Pln | |
| Chemat | 25g | 1317.20 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5,6-dibromo-1,2-dihydroacenaphthylene (CAS 19190-91-1) is a chemical compound with the molecular formula C12H8Br2 and a molecular weight of 312.00 g/mol. IUPAC name: 5,6-dibromo-1,2-dihydroacenaphthylene. InChIKey: UXSHNPXCELYWAW-UHFFFAOYSA-N.
| Molecular formula | C12H8Br2 |
|---|---|
| Molecular weight | 312.00 g/mol |
| IUPAC name | 5,6-dibromo-1,2-dihydroacenaphthylene |
| InChIKey | UXSHNPXCELYWAW-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=C(C3=C(C=CC1=C23)Br)Br |
Computed by PubChem (NCBI)