Products 80523-79-1
CAS 80523-79-1 appears in our catalog under these names: 4,4'-Dibromobiphenyl-d8, 99 atom % D, min 98% Chemical Purity, 4',4-Dibromobiphenyl-d8. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 1 mg.
1-bromo-4-(4-bromo-2,3,5,6-tetradeuteriophenyl)-2,3,5,6-tetradeuteriobenzene (CAS 80523-79-1) is a chemical compound with the molecular formula C12H8Br2 and a molecular weight of 320.05 g/mol. IUPAC name: 1-bromo-4-(4-bromo-2,3,5,6-tetradeuteriophenyl)-2,3,5,6-tetradeuteriobenzene. InChIKey: HQJQYILBCQPYBI-PGRXLJNUSA-N.
| Molecular formula | C12H8Br2 |
|---|---|
| Molecular weight | 320.05 g/mol |
| IUPAC name | 1-bromo-4-(4-bromo-2,3,5,6-tetradeuteriophenyl)-2,3,5,6-tetradeuteriobenzene |
| InChIKey | HQJQYILBCQPYBI-PGRXLJNUSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C2=C(C(=C(C(=C2[2H])[2H])Br)[2H])[2H])[2H])[2H])Br)[2H] |
Computed by PubChem (NCBI)