cas: 6478-80-4 — see every product listed under this CAS number, including other names
5,6-Dichloro-2-(hydroxymethyl)benzimidazole, 97% (CAS 6478-80-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg, 500mg. Offered by: AmBeed, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A138827-1g |
| cas | 6478-80-4 |
| size | 1g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 5004.58 Pln | |
| AmBeed | 10g | 17992.03 Pln | |
| AmBeed | 5g | 14880.25 Pln | |
| Chemat | 100mg | 246.80 Pln | |
| Chemat | 250mg | 525.20 Pln | |
| Chemat | 500mg | 981.20 Pln | |
| Chemat | 1g | 1883.60 Pln | |
| Chemat | 5g | 5920.40 Pln | |
| Chemat | 10g | 10058.00 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(5,6-dichloro-1H-benzimidazol-2-yl)methanol (CAS 6478-80-4) is a chemical compound with the molecular formula C8H6Cl2N2O and a molecular weight of 217.05 g/mol. IUPAC name: (5,6-dichloro-1H-benzimidazol-2-yl)methanol. InChIKey: GOUGSJWBRLTBDO-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2O |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | (5,6-dichloro-1H-benzimidazol-2-yl)methanol |
| InChIKey | GOUGSJWBRLTBDO-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1Cl)Cl)N=C(N2)CO |
Computed by PubChem (NCBI)