CAS 2304654-72-4 is the registry number for 6,8-Dichloro-3,4-dihydro-2,7-naphthyridin-1(2H)-one, 95%. Offered by: AmBeed. Available pack sizes: 1g.
6,8-dichloro-3,4-dihydro-2H-2,7-naphthyridin-1-one (CAS 2304654-72-4) is a chemical compound with the molecular formula C8H6Cl2N2O and a molecular weight of 217.05 g/mol. IUPAC name: 6,8-dichloro-3,4-dihydro-2H-2,7-naphthyridin-1-one. InChIKey: AAABRPMPSVUIQV-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2N2O |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 6,8-dichloro-3,4-dihydro-2H-2,7-naphthyridin-1-one |
| InChIKey | AAABRPMPSVUIQV-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C(N=C(C=C21)Cl)Cl |
Computed by PubChem (NCBI)