5,6-Dichloroindolin-2-one, 98%
cas: 71293-59-9 — see every product listed under this CAS number, including other names
5,6-Dichloroindolin-2-one, 98% (CAS 71293-59-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F220040-250MG |
| cas | 71293-59-9 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 305.12 Pln | |
| Fluorochem | 5g | 883.04 Pln | |
| Fluorochem | 25g | 3673.72 Pln | |
| Ambeed | 250mg | 192.38 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 782.00 Pln | |
| Ambeed | 25g | 3112.69 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 530.00 Pln | |
| BLDpharm | 250mg | 181.07 Pln | |
| BLDpharm | 1g | 297.70 Pln | |
| BLDpharm | 5g | 841.95 Pln | |
| BLDpharm | 25g | 3352.18 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
5,6-dichloro-1,3-dihydroindol-2-one (CAS 71293-59-9) is a chemical compound with the molecular formula C8H5Cl2NO and a molecular weight of 202.03 g/mol. IUPAC name: 5,6-dichloro-1,3-dihydroindol-2-one. InChIKey: ADDAYZCZQHOPJX-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO |
|---|---|
| Molecular weight | 202.03 g/mol |
| IUPAC name | 5,6-dichloro-1,3-dihydroindol-2-one |
| InChIKey | ADDAYZCZQHOPJX-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2NC1=O)Cl)Cl |
Computed by PubChem (NCBI)