5,6-Difluoro-1H-indene-1,3(2H)-dione, 97%
cas: 1454686-04-4 — see every product listed under this CAS number, including other names
5,6-Difluoro-1H-indene-1,3(2H)-dione, 97% (CAS 1454686-04-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 50mg, 100mg. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A791805-250mg |
| cas | 1454686-04-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2684.38 Pln | |
| BLDpharm | 50mg | 269.93 Pln | |
| BLDpharm | 100mg | 314.36 Pln | |
| BLDpharm | 250mg | 364.34 Pln | |
| BLDpharm | 1g | 803.08 Pln | |
| BLDpharm | 5g | 2624.66 Pln | |
| Fluorochem | 100mg | 268.67 Pln | |
| Fluorochem | 250mg | 351.98 Pln | |
| Fluorochem | 1g | 732.05 Pln | |
| Fluorochem | 5g | 2465.82 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5,6-difluoroindene-1,3-dione (CAS 1454686-04-4) is a chemical compound with the molecular formula C9H4F2O2 and a molecular weight of 182.12 g/mol. IUPAC name: 5,6-difluoroindene-1,3-dione. InChIKey: HDMHJXOJLIYDFU-UHFFFAOYSA-N.
| Molecular formula | C9H4F2O2 |
|---|---|
| Molecular weight | 182.12 g/mol |
| IUPAC name | 5,6-difluoroindene-1,3-dione |
| InChIKey | HDMHJXOJLIYDFU-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=CC(=C(C=C2C1=O)F)F |
Computed by PubChem (NCBI)