cas: 4790-08-3 — see every product listed under this CAS number, including other names
5,6-Dihydroxy-1H-indole-2-carboxylic acid, 95% (CAS 4790-08-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat, Fluorochem, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch11DDBG-25mg |
| cas | 4790-08-3 |
| size | 25mg |
| availability | 25g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 122.00 Pln | |
| Chemat | 100mg | 251.60 Pln | |
| Chemat | 250mg | 424.40 Pln | |
| Chemat | 1g | 1437.20 Pln | |
| Chemat | 5g | 6237.20 Pln | |
| Fluorochem | 250mg | 430.07 Pln | |
| Fluorochem | 1g | 1476.58 Pln | |
| BLDpharm | 100mg | 275.48 Pln | |
| BLDpharm | 250mg | 458.75 Pln | |
| BLDpharm | 1g | 1541.70 Pln | |
| BLDpharm | 5g | 6689.89 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5,6-dihydroxyindole-2-carboxylic acid is a dihydroxyindole that is indole-2-carboxylic acid substituted by hydroxy groups at positions 5 and 6. It has a role as a mouse metabolite. It is a conjugate acid of a 5,6-dihydroxyindole-2-carboxylate. It is a tautomer of a dopachrome.
Source: ChEBI
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 5,6-dihydroxy-1H-indole-2-carboxylic acid |
| InChIKey | YFTGOBNOJKXZJC-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(NC2=CC(=C1O)O)C(=O)O |
Computed by PubChem (NCBI)